C27H22ClF2N3O4 — CID 155145791
(1S)-N-[(3-chloro-2,4-difluorophenyl)methyl]-5,8-dioxo-6-phenylmethoxy-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,12-triene-4-carboxamide (PubChem CID 155145791) has the molecular formula C27H22ClF2N3O4 and a molecular weight of 525.94 g/mol. Its IUPAC name is (1S)-N-[(3-chloro-2,4-difluorophenyl)methyl]-5,8-dioxo-6-phenylmethoxy-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,12-triene-4-carboxamide.
| Compound Name | (1S)-N-[(3-chloro-2,4-difluorophenyl)methyl]-5,8-dioxo-6-phenylmethoxy-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,12-triene-4-carboxamide |
|---|---|
| PubChem CID | 155145791 |
| Molecular Formula | C27H22ClF2N3O4 |
| Molecular Weight | 525.94 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | (1S)-N-[(3-chloro-2,4-difluorophenyl)methyl]-5,8-dioxo-6-phenylmethoxy-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6,12-triene-4-carboxamide |
| SMILES | O=C(NCc1ccc(F)c(Cl)c1F)c1cn2c(c(OCc3ccccc3)c1=O)C(=O)N1CCC=C[C@H]2C1 |
| InChI | InChI=1S/C27H22ClF2N3O4/c28-21-20(29)10-9-17(22(21)30)12-31-26(35)19-14-33-18-8-4-5-11-32(13-18)27(36)23(33)25(24(19)34)37-15-16-6-2-1-3-7-16/h1-4,6-10,14,18H,5,11-13,15H2,(H,31,35)/t18-/m0/s1 |
| InChIKey | VNKYKNCJFIIPKK-SFHVURJKSA-N |
| XLogP | 4.25 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.94 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|