C19H10F3N5O2 — CID 155151638
12-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-16,18-dioxa-5,6,11-triazapentacyclo[11.7.0.02,10.03,7.015,19]icosa-1(20),2(10),3(7),4,8,11,13,15(19)-octaene (PubChem CID 155151638) has the molecular formula C19H10F3N5O2 and a molecular weight of 397.32 g/mol. Its IUPAC name is 12-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-16,18-dioxa-5,6,11-triazapentacyclo[11.7.0.02,10.03,7.015,19]icosa-1(20),2(10),3(7),4,8,11,13,15(19)-octaene.
| Compound Name | 12-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-16,18-dioxa-5,6,11-triazapentacyclo[11.7.0.02,10.03,7.015,19]icosa-1(20),2(10),3(7),4,8,11,13,15(19)-octaene |
|---|---|
| PubChem CID | 155151638 |
| Molecular Formula | C19H10F3N5O2 |
| Molecular Weight | 397.32 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 12-[5-(trifluoromethyl)-1H-pyrazol-4-yl]-16,18-dioxa-5,6,11-triazapentacyclo[11.7.0.02,10.03,7.015,19]icosa-1(20),2(10),3(7),4,8,11,13,15(19)-octaene |
| SMILES | FC(F)(F)c1[nH]ncc1-c1nc2ccc3[nH]ncc3c2c2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C19H10F3N5O2/c20-19(21,22)18-11(6-24-27-18)17-9-4-15-14(28-7-29-15)3-8(9)16-10-5-23-26-12(10)1-2-13(16)25-17/h1-6H,7H2,(H,23,26)(H,24,27) |
| InChIKey | SXJNZSSQGXWYNG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.32 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|