C21H32O6 — CID 155152343
(9Z)-9-ethenyl-10-methyl-2,5,8,11,15,19-hexaoxabicyclo[18.4.0]tetracosa-1(24),9,22-triene (PubChem CID 155152343) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is (9Z)-9-ethenyl-10-methyl-2,5,8,11,15,19-hexaoxabicyclo[18.4.0]tetracosa-1(24),9,22-triene.
| Compound Name | (9Z)-9-ethenyl-10-methyl-2,5,8,11,15,19-hexaoxabicyclo[18.4.0]tetracosa-1(24),9,22-triene |
|---|---|
| PubChem CID | 155152343 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | (9Z)-9-ethenyl-10-methyl-2,5,8,11,15,19-hexaoxabicyclo[18.4.0]tetracosa-1(24),9,22-triene |
| SMILES | C=C/C1=C(\C)OCCCOCCCOC2CC=CC=C2OCCOCCO1 |
| InChI | InChI=1S/C21H32O6/c1-3-19-18(2)24-12-6-10-22-11-7-13-25-20-8-4-5-9-21(20)27-17-15-23-14-16-26-19/h3-5,9,20H,1,6-8,10-17H2,2H3/b19-18- |
| InChIKey | FMKAKAUTKDQTAJ-HNENSFHCSA-N |
| XLogP | 3.51 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |