C13H12ClFN4O2 — CID 155161968
ethyl N-[4-[(5-chloropyrimidin-2-yl)amino]-3-fluorophenyl]carbamate (PubChem CID 155161968) has the molecular formula C13H12ClFN4O2 and a molecular weight of 310.72 g/mol. Its IUPAC name is ethyl N-[4-[(5-chloropyrimidin-2-yl)amino]-3-fluorophenyl]carbamate.
| Compound Name | ethyl N-[4-[(5-chloropyrimidin-2-yl)amino]-3-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 155161968 |
| Molecular Formula | C13H12ClFN4O2 |
| Molecular Weight | 310.72 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | ethyl N-[4-[(5-chloropyrimidin-2-yl)amino]-3-fluorophenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(Nc2ncc(Cl)cn2)c(F)c1 |
| InChI | InChI=1S/C13H12ClFN4O2/c1-2-21-13(20)18-9-3-4-11(10(15)5-9)19-12-16-6-8(14)7-17-12/h3-7H,2H2,1H3,(H,18,20)(H,16,17,19) |
| InChIKey | HVVGYYZOLFFRFU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.72 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |