C23H28O10 — CID 155162655
[(2S,3R,4S,5R,6R)-2,5-dihydroxy-6-(hydroxymethyl)-3-methoxyoxan-4-yl] 2-methoxy-6-methyl-4-phenylmethoxybenzenecarboperoxoate (PubChem CID 155162655) has the molecular formula C23H28O10 and a molecular weight of 464.47 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-2,5-dihydroxy-6-(hydroxymethyl)-3-methoxyoxan-4-yl] 2-methoxy-6-methyl-4-phenylmethoxybenzenecarboperoxoate.
| Compound Name | [(2S,3R,4S,5R,6R)-2,5-dihydroxy-6-(hydroxymethyl)-3-methoxyoxan-4-yl] 2-methoxy-6-methyl-4-phenylmethoxybenzenecarboperoxoate |
|---|---|
| PubChem CID | 155162655 |
| Molecular Formula | C23H28O10 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-2,5-dihydroxy-6-(hydroxymethyl)-3-methoxyoxan-4-yl] 2-methoxy-6-methyl-4-phenylmethoxybenzenecarboperoxoate |
| SMILES | COc1cc(OCc2ccccc2)cc(C)c1C(=O)OO[C@H]1[C@H](O)[C@@H](CO)O[C@H](O)[C@@H]1OC |
| InChI | InChI=1S/C23H28O10/c1-13-9-15(30-12-14-7-5-4-6-8-14)10-16(28-2)18(13)22(26)33-32-20-19(25)17(11-24)31-23(27)21(20)29-3/h4-10,17,19-21,23-25,27H,11-12H2,1-3H3/t17-,19-,20+,21-,23+/m1/s1 |
| InChIKey | OVMVWSZHVVQSEN-SQKWCZRTSA-N |
| XLogP | 1.13 |
| TPSA | 133.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|