About 2-[2-acetyloxy-3-bromo-5-[oxan-4-yl(phenyl)methyl]pyrido[3,2-b]indol-7-yl]acetic acid
2-[2-acetyloxy-3-bromo-5-[oxan-4-yl(phenyl)methyl]pyrido[3,2-b]indol-7-yl]acetic acid (PubChem CID 155166462) has the molecular formula C27H25BrN2O5
and a molecular weight of 537.41 g/mol. Its IUPAC name is 2-[2-acetyloxy-3-bromo-5-[oxan-4-yl(phenyl)methyl]pyrido[3,2-b]indol-7-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-acetyloxy-3-bromo-5-[oxan-4-yl(phenyl)methyl]pyrido[3,2-b]indol-7-yl]acetic acid |
| PubChem CID | 155166462 |
| Molecular Formula | C27H25BrN2O5 |
| Molecular Weight | 537.41 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | 2-[2-acetyloxy-3-bromo-5-[oxan-4-yl(phenyl)methyl]pyrido[3,2-b]indol-7-yl]acetic acid |
| SMILES | CC(=O)Oc1nc2c3ccc(CC(=O)O)cc3n(C(c3ccccc3)C3CCOCC3)c2cc1Br |
| InChI | InChI=1S/C27H25BrN2O5/c1-16(31)35-27-21(28)15-23-25(29-27)20-8-7-17(14-24(32)33)13-22(20)30(23)26(18-5-3-2-4-6-18)19-9-11-34-12-10-19/h2-8,13,15,19,26H,9-12,14H2,1H3,(H,32,33) |
| InChIKey | NVFWPKIHMMKADO-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 537.41 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[2-acetyloxy-3-bromo-5-[oxan-4-yl(phenyl)methyl]pyrido[3,2-b]indol-7-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-acetyloxy-3-bromo-5-[oxan-4-yl(phenyl)methyl]pyrido[3,2-b]indol-7-yl]acetic acid?
The IUPAC name of 2-[2-acetyloxy-3-bromo-5-[oxan-4-yl(phenyl)methyl]pyrido[3,2-b]indol-7-yl]acetic acid (CID 155166462) is 2-[2-acetyloxy-3-bromo-5-[oxan-4-yl(phenyl)methyl]pyrido[3,2-b]indol-7-yl]acetic acid.
What is the SMILES notation for 2-[2-acetyloxy-3-bromo-5-[oxan-4-yl(phenyl)methyl]pyrido[3,2-b]indol-7-yl]acetic acid?
The canonical SMILES for 2-[2-acetyloxy-3-bromo-5-[oxan-4-yl(phenyl)methyl]pyrido[3,2-b]indol-7-yl]acetic acid is CC(=O)Oc1nc2c3ccc(CC(=O)O)cc3n(C(c3ccccc3)C3CCOCC3)c2cc1Br.
What is the InChIKey of 2-[2-acetyloxy-3-bromo-5-[oxan-4-yl(phenyl)methyl]pyrido[3,2-b]indol-7-yl]acetic acid?
The InChIKey is NVFWPKIHMMKADO-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25BrN2O5/c1-16(31)35-27-21(28)15-23-25(29-27)20-8-7-17(14-24(32)33)13-22(20)30(23)26(18-5-3-2-4-6-18)19-9-11-34-12-10-19/h2-8,13,15,19,26H,9-12,14H2,1H3,(H,32,33).
What are the key properties of 2-[2-acetyloxy-3-bromo-5-[oxan-4-yl(phenyl)methyl]pyrido[3,2-b]indol-7-yl]acetic acid?
2-[2-acetyloxy-3-bromo-5-[oxan-4-yl(phenyl)methyl]pyrido[3,2-b]indol-7-yl]acetic acid has a molecular weight of 537.41 g/mol, XLogP of 5.52, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-acetyloxy-3-bromo-5-[oxan-4-yl(phenyl)methyl]pyrido[3,2-b]indol-7-yl]acetic acid is sourced from PubChem (CID 155166462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).