C17H21BrN4O2 — CID 155167221
tert-butyl N-[(1S)-1-[3-(5-bromo-2-pyridinyl)-5-methylpyrazin-2-yl]ethyl]carbamate (PubChem CID 155167221) has the molecular formula C17H21BrN4O2 and a molecular weight of 393.29 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[3-(5-bromo-2-pyridinyl)-5-methylpyrazin-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[3-(5-bromo-2-pyridinyl)-5-methylpyrazin-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 155167221 |
| Molecular Formula | C17H21BrN4O2 |
| Molecular Weight | 393.29 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | tert-butyl N-[(1S)-1-[3-(5-bromo-2-pyridinyl)-5-methylpyrazin-2-yl]ethyl]carbamate |
| SMILES | Cc1cnc([C@H](C)NC(=O)OC(C)(C)C)c(-c2ccc(Br)cn2)n1 |
| InChI | InChI=1S/C17H21BrN4O2/c1-10-8-20-14(11(2)22-16(23)24-17(3,4)5)15(21-10)13-7-6-12(18)9-19-13/h6-9,11H,1-5H3,(H,22,23)/t11-/m0/s1 |
| InChIKey | ZTKLPPXDMQPQFM-NSHDSACASA-N |
| XLogP | 4.20 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.29 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |