C30H40N2O5 — CID 155172112
N-[(4aR)-2-(cyclopropylmethyl)-4a-(2,3-dihydroxy-6-methylphenyl)-8a-hydroxy-1-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(furan-3-yl)-N-methylcyclopropane-1-carboxamide (PubChem CID 155172112) has the molecular formula C30H40N2O5 and a molecular weight of 508.66 g/mol. Its IUPAC name is N-[(4aR)-2-(cyclopropylmethyl)-4a-(2,3-dihydroxy-6-methylphenyl)-8a-hydroxy-1-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(furan-3-yl)-N-methylcyclopropane-1-carboxamide.
| Compound Name | N-[(4aR)-2-(cyclopropylmethyl)-4a-(2,3-dihydroxy-6-methylphenyl)-8a-hydroxy-1-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(furan-3-yl)-N-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 155172112 |
| Molecular Formula | C30H40N2O5 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | N-[(4aR)-2-(cyclopropylmethyl)-4a-(2,3-dihydroxy-6-methylphenyl)-8a-hydroxy-1-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(furan-3-yl)-N-methylcyclopropane-1-carboxamide |
| SMILES | Cc1ccc(O)c(O)c1[C@]12CCN(CC3CC3)C(C)C1(O)CCC(N(C)C(=O)C1CC1c1ccoc1)C2 |
| InChI | InChI=1S/C30H40N2O5/c1-18-4-7-25(33)27(34)26(18)29-11-12-32(16-20-5-6-20)19(2)30(29,36)10-8-22(15-29)31(3)28(35)24-14-23(24)21-9-13-37-17-21/h4,7,9,13,17,19-20,22-24,33-34,36H,5-6,8,10-12,14-16H2,1-3H3/t19?,22?,23?,24?,29-,30?/m1/s1 |
| InChIKey | LXTKZGKKFJREQC-QEOCQVKSSA-N |
| XLogP | 4.29 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|