C14H11F3N4 — CID 155187420
N-benzyl-5-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 155187420) has the molecular formula C14H11F3N4 and a molecular weight of 292.26 g/mol. Its IUPAC name is N-benzyl-5-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-benzyl-5-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 155187420 |
| Molecular Formula | C14H11F3N4 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | N-benzyl-5-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | FC(F)(F)c1c[nH]c2ncnc(NCc3ccccc3)c12 |
| InChI | InChI=1S/C14H11F3N4/c15-14(16,17)10-7-19-13-11(10)12(20-8-21-13)18-6-9-4-2-1-3-5-9/h1-5,7-8H,6H2,(H2,18,19,20,21) |
| InChIKey | GLBCJTDKQMHWNW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |