C18H20N2O2S2 — CID 15518927
(2S,3R,4S)-N,N-dimethyl-2-(4-methylphenyl)-3-nitro-6-thiophen-2-yl-3,4-dihydro-2H-thiopyran-4-amine (PubChem CID 15518927) has the molecular formula C18H20N2O2S2 and a molecular weight of 360.50 g/mol. Its IUPAC name is (2S,3R,4S)-N,N-dimethyl-2-(4-methylphenyl)-3-nitro-6-thiophen-2-yl-3,4-dihydro-2H-thiopyran-4-amine.
| Compound Name | (2S,3R,4S)-N,N-dimethyl-2-(4-methylphenyl)-3-nitro-6-thiophen-2-yl-3,4-dihydro-2H-thiopyran-4-amine |
|---|---|
| PubChem CID | 15518927 |
| Molecular Formula | C18H20N2O2S2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (2S,3R,4S)-N,N-dimethyl-2-(4-methylphenyl)-3-nitro-6-thiophen-2-yl-3,4-dihydro-2H-thiopyran-4-amine |
| SMILES | Cc1ccc([C@@H]2SC(c3cccs3)=C[C@H](N(C)C)[C@H]2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H20N2O2S2/c1-12-6-8-13(9-7-12)18-17(20(21)22)14(19(2)3)11-16(24-18)15-5-4-10-23-15/h4-11,14,17-18H,1-3H3/t14-,17+,18-/m0/s1 |
| InChIKey | CIWMEAPBINQVQU-QGTPRVQTSA-N |
| XLogP | 4.46 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|