C15H16N2O2S3 — CID 15518932
(2R,3R,4S)-N,N-dimethyl-3-nitro-2,6-dithiophen-2-yl-3,4-dihydro-2H-thiopyran-4-amine (PubChem CID 15518932) has the molecular formula C15H16N2O2S3 and a molecular weight of 352.51 g/mol. Its IUPAC name is (2R,3R,4S)-N,N-dimethyl-3-nitro-2,6-dithiophen-2-yl-3,4-dihydro-2H-thiopyran-4-amine.
| Compound Name | (2R,3R,4S)-N,N-dimethyl-3-nitro-2,6-dithiophen-2-yl-3,4-dihydro-2H-thiopyran-4-amine |
|---|---|
| PubChem CID | 15518932 |
| Molecular Formula | C15H16N2O2S3 |
| Molecular Weight | 352.51 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | (2R,3R,4S)-N,N-dimethyl-3-nitro-2,6-dithiophen-2-yl-3,4-dihydro-2H-thiopyran-4-amine |
| SMILES | CN(C)[C@H]1C=C(c2cccs2)S[C@@H](c2cccs2)[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C15H16N2O2S3/c1-16(2)10-9-13(11-5-3-7-20-11)22-15(14(10)17(18)19)12-6-4-8-21-12/h3-10,14-15H,1-2H3/t10-,14+,15-/m0/s1 |
| InChIKey | XEWPQFPCBRNGGH-VQISRLSMSA-N |
| XLogP | 4.21 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|