C15H12N2O6 — CID 155196123
[6-[(2,5-diformylphenoxy)methyl]-2-pyridinyl]methyl nitrate (PubChem CID 155196123) has the molecular formula C15H12N2O6 and a molecular weight of 316.27 g/mol. Its IUPAC name is [6-[(2,5-diformylphenoxy)methyl]-2-pyridinyl]methyl nitrate.
| Compound Name | [6-[(2,5-diformylphenoxy)methyl]-2-pyridinyl]methyl nitrate |
|---|---|
| PubChem CID | 155196123 |
| Molecular Formula | C15H12N2O6 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | [6-[(2,5-diformylphenoxy)methyl]-2-pyridinyl]methyl nitrate |
| SMILES | O=Cc1ccc(C=O)c(OCc2cccc(CO[N+](=O)[O-])n2)c1 |
| InChI | InChI=1S/C15H12N2O6/c18-7-11-4-5-12(8-19)15(6-11)22-9-13-2-1-3-14(16-13)10-23-17(20)21/h1-8H,9-10H2 |
| InChIKey | LVRFUXOPORKTQK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 108.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|