C14H24FN — CID 155197638
(3Z,5Z)-N-(2-fluoroethyl)-N-methyl-2-methylidene-5-propan-2-ylhepta-3,5-dien-1-amine (PubChem CID 155197638) has the molecular formula C14H24FN and a molecular weight of 225.35 g/mol. Its IUPAC name is (3Z,5Z)-N-(2-fluoroethyl)-N-methyl-2-methylidene-5-propan-2-ylhepta-3,5-dien-1-amine.
| Compound Name | (3Z,5Z)-N-(2-fluoroethyl)-N-methyl-2-methylidene-5-propan-2-ylhepta-3,5-dien-1-amine |
|---|---|
| PubChem CID | 155197638 |
| Molecular Formula | C14H24FN |
| Molecular Weight | 225.35 g/mol |
| Exact Mass | 225.19 |
| IUPAC Name | (3Z,5Z)-N-(2-fluoroethyl)-N-methyl-2-methylidene-5-propan-2-ylhepta-3,5-dien-1-amine |
| SMILES | C=C(/C=C\C(=C/C)C(C)C)CN(C)CCF |
| InChI | InChI=1S/C14H24FN/c1-6-14(12(2)3)8-7-13(4)11-16(5)10-9-15/h6-8,12H,4,9-11H2,1-3,5H3/b8-7-,14-6+ |
| InChIKey | FAEXCJAPDJHRCC-FBOINPIASA-N |
| XLogP | 3.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|