C16H28F3NO3 — CID 155199344
tert-butyl N-propyl-N-(7,7,7-trifluoro-6-formylheptan-3-yl)carbamate (PubChem CID 155199344) has the molecular formula C16H28F3NO3 and a molecular weight of 339.40 g/mol. Its IUPAC name is tert-butyl N-propyl-N-(7,7,7-trifluoro-6-formylheptan-3-yl)carbamate.
| Compound Name | tert-butyl N-propyl-N-(7,7,7-trifluoro-6-formylheptan-3-yl)carbamate |
|---|---|
| PubChem CID | 155199344 |
| Molecular Formula | C16H28F3NO3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | tert-butyl N-propyl-N-(7,7,7-trifluoro-6-formylheptan-3-yl)carbamate |
| SMILES | CCCN(C(=O)OC(C)(C)C)C(CC)CCC(C=O)C(F)(F)F |
| InChI | InChI=1S/C16H28F3NO3/c1-6-10-20(14(22)23-15(3,4)5)13(7-2)9-8-12(11-21)16(17,18)19/h11-13H,6-10H2,1-5H3 |
| InChIKey | YZLLVTUGOVTYMI-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|