C16H19N — CID 155199348
3-ethyl-5-methyl-2-[(1Z)-3-methylbuta-1,3-dienyl]-1H-indole (PubChem CID 155199348) has the molecular formula C16H19N and a molecular weight of 225.33 g/mol. Its IUPAC name is 3-ethyl-5-methyl-2-[(1Z)-3-methylbuta-1,3-dienyl]-1H-indole.
| Compound Name | 3-ethyl-5-methyl-2-[(1Z)-3-methylbuta-1,3-dienyl]-1H-indole |
|---|---|
| PubChem CID | 155199348 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 3-ethyl-5-methyl-2-[(1Z)-3-methylbuta-1,3-dienyl]-1H-indole |
| SMILES | C=C(C)/C=C\c1[nH]c2ccc(C)cc2c1CC |
| InChI | InChI=1S/C16H19N/c1-5-13-14-10-12(4)7-9-16(14)17-15(13)8-6-11(2)3/h6-10,17H,2,5H2,1,3-4H3/b8-6- |
| InChIKey | ANVPKYPKGIPEEB-VURMDHGXSA-N |
| XLogP | 4.63 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|