C10H15NO — CID 155204673
2-amino-3-ethyl-6-methylcyclohepta-1,3,6-trien-1-ol (PubChem CID 155204673) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 2-amino-3-ethyl-6-methylcyclohepta-1,3,6-trien-1-ol.
| Compound Name | 2-amino-3-ethyl-6-methylcyclohepta-1,3,6-trien-1-ol |
|---|---|
| PubChem CID | 155204673 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 2-amino-3-ethyl-6-methylcyclohepta-1,3,6-trien-1-ol |
| SMILES | CCC1=CCC(C)=CC(O)=C1N |
| InChI | InChI=1S/C10H15NO/c1-3-8-5-4-7(2)6-9(12)10(8)11/h5-6,12H,3-4,11H2,1-2H3 |
| InChIKey | RHBIGVMWUQIRSA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |