C27H26ClN5O3 — CID 155206375
1-(4-chlorophenyl)-3-[4-[7-(4-methoxypiperidin-1-yl)quinazolin-4-yl]oxyphenyl]urea (PubChem CID 155206375) has the molecular formula C27H26ClN5O3 and a molecular weight of 503.99 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[4-[7-(4-methoxypiperidin-1-yl)quinazolin-4-yl]oxyphenyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[4-[7-(4-methoxypiperidin-1-yl)quinazolin-4-yl]oxyphenyl]urea |
|---|---|
| PubChem CID | 155206375 |
| Molecular Formula | C27H26ClN5O3 |
| Molecular Weight | 503.99 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[4-[7-(4-methoxypiperidin-1-yl)quinazolin-4-yl]oxyphenyl]urea |
| SMILES | COC1CCN(c2ccc3c(Oc4ccc(NC(=O)Nc5ccc(Cl)cc5)cc4)ncnc3c2)CC1 |
| InChI | InChI=1S/C27H26ClN5O3/c1-35-22-12-14-33(15-13-22)21-8-11-24-25(16-21)29-17-30-26(24)36-23-9-6-20(7-10-23)32-27(34)31-19-4-2-18(28)3-5-19/h2-11,16-17,22H,12-15H2,1H3,(H2,31,32,34) |
| InChIKey | JQKCOTLZRULGMD-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.99 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |