C26H24ClN5O4 — CID 2814126
1-[6-(7-chloroquinazolin-4-yl)oxy-3-pyridinyl]-3-(3-cyclopentyloxy-4-methoxyphenyl)urea (PubChem CID 2814126) has the molecular formula C26H24ClN5O4 and a molecular weight of 505.96 g/mol. Its IUPAC name is 1-[6-(7-chloroquinazolin-4-yl)oxy-3-pyridinyl]-3-(3-cyclopentyloxy-4-methoxyphenyl)urea.
| Compound Name | 1-[6-(7-chloroquinazolin-4-yl)oxy-3-pyridinyl]-3-(3-cyclopentyloxy-4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 2814126 |
| Molecular Formula | C26H24ClN5O4 |
| Molecular Weight | 505.96 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 1-[6-(7-chloroquinazolin-4-yl)oxy-3-pyridinyl]-3-(3-cyclopentyloxy-4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2ccc(Oc3ncnc4cc(Cl)ccc34)nc2)cc1OC1CCCC1 |
| InChI | InChI=1S/C26H24ClN5O4/c1-34-22-10-7-17(13-23(22)35-19-4-2-3-5-19)31-26(33)32-18-8-11-24(28-14-18)36-25-20-9-6-16(27)12-21(20)29-15-30-25/h6-15,19H,2-5H2,1H3,(H2,31,32,33) |
| InChIKey | CMDAQLXZGWQKFG-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.96 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |