C7H8FN3O2 — CID 155209306
(6-amino-3-fluoro-2-pyridinyl)methylcarbamic acid (PubChem CID 155209306) has the molecular formula C7H8FN3O2 and a molecular weight of 185.16 g/mol. Its IUPAC name is (6-amino-3-fluoro-2-pyridinyl)methylcarbamic acid.
| Compound Name | (6-amino-3-fluoro-2-pyridinyl)methylcarbamic acid |
|---|---|
| PubChem CID | 155209306 |
| Molecular Formula | C7H8FN3O2 |
| Molecular Weight | 185.16 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | (6-amino-3-fluoro-2-pyridinyl)methylcarbamic acid |
| SMILES | Nc1ccc(F)c(CNC(=O)O)n1 |
| InChI | InChI=1S/C7H8FN3O2/c8-4-1-2-6(9)11-5(4)3-10-7(12)13/h1-2,10H,3H2,(H2,9,11)(H,12,13) |
| InChIKey | DHPWOCZRZNYLOO-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.16 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |