C21H20N4 — CID 155211393
3-methyl-4-[3-(3-phenylphenyl)-1H-pyrazol-5-yl]pyrrolidine-1-carbonitrile (PubChem CID 155211393) has the molecular formula C21H20N4 and a molecular weight of 328.42 g/mol. Its IUPAC name is 3-methyl-4-[3-(3-phenylphenyl)-1H-pyrazol-5-yl]pyrrolidine-1-carbonitrile.
| Compound Name | 3-methyl-4-[3-(3-phenylphenyl)-1H-pyrazol-5-yl]pyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 155211393 |
| Molecular Formula | C21H20N4 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 3-methyl-4-[3-(3-phenylphenyl)-1H-pyrazol-5-yl]pyrrolidine-1-carbonitrile |
| SMILES | CC1CN(C#N)CC1c1cc(-c2cccc(-c3ccccc3)c2)n[nH]1 |
| InChI | InChI=1S/C21H20N4/c1-15-12-25(14-22)13-19(15)21-11-20(23-24-21)18-9-5-8-17(10-18)16-6-3-2-4-7-16/h2-11,15,19H,12-13H2,1H3,(H,23,24) |
| InChIKey | GQOVQYRSSCXBDH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 55.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|