C17H15N5O — CID 130454562
3-[3-[3-(1,2-oxazol-4-yl)phenyl]-1H-pyrazol-5-yl]pyrrolidine-1-carbonitrile (PubChem CID 130454562) has the molecular formula C17H15N5O and a molecular weight of 305.34 g/mol. Its IUPAC name is 3-[3-[3-(1,2-oxazol-4-yl)phenyl]-1H-pyrazol-5-yl]pyrrolidine-1-carbonitrile.
| Compound Name | 3-[3-[3-(1,2-oxazol-4-yl)phenyl]-1H-pyrazol-5-yl]pyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 130454562 |
| Molecular Formula | C17H15N5O |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 3-[3-[3-(1,2-oxazol-4-yl)phenyl]-1H-pyrazol-5-yl]pyrrolidine-1-carbonitrile |
| SMILES | N#CN1CCC(c2cc(-c3cccc(-c4cnoc4)c3)n[nH]2)C1 |
| InChI | InChI=1S/C17H15N5O/c18-11-22-5-4-14(9-22)17-7-16(20-21-17)13-3-1-2-12(6-13)15-8-19-23-10-15/h1-3,6-8,10,14H,4-5,9H2,(H,20,21) |
| InChIKey | MXBSCRKPYWEOEV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 81.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|