C15H16N4 — CID 130454492
(3R,4R)-3-methyl-4-(3-phenyl-1H-pyrazol-5-yl)pyrrolidine-1-carbonitrile (PubChem CID 130454492) has the molecular formula C15H16N4 and a molecular weight of 252.32 g/mol. Its IUPAC name is (3R,4R)-3-methyl-4-(3-phenyl-1H-pyrazol-5-yl)pyrrolidine-1-carbonitrile.
| Compound Name | (3R,4R)-3-methyl-4-(3-phenyl-1H-pyrazol-5-yl)pyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 130454492 |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (3R,4R)-3-methyl-4-(3-phenyl-1H-pyrazol-5-yl)pyrrolidine-1-carbonitrile |
| SMILES | C[C@H]1CN(C#N)C[C@@H]1c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C15H16N4/c1-11-8-19(10-16)9-13(11)15-7-14(17-18-15)12-5-3-2-4-6-12/h2-7,11,13H,8-9H2,1H3,(H,17,18)/t11-,13-/m0/s1 |
| InChIKey | HHDCQGWYINSJKC-AAEUAGOBSA-N |
| XLogP | 2.59 |
| TPSA | 55.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|