C19H17N5 — CID 130454663
3-[3-(4-phenyl-2-pyridinyl)-1H-pyrazol-5-yl]pyrrolidine-1-carbonitrile (PubChem CID 130454663) has the molecular formula C19H17N5 and a molecular weight of 315.38 g/mol. Its IUPAC name is 3-[3-(4-phenyl-2-pyridinyl)-1H-pyrazol-5-yl]pyrrolidine-1-carbonitrile.
| Compound Name | 3-[3-(4-phenyl-2-pyridinyl)-1H-pyrazol-5-yl]pyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 130454663 |
| Molecular Formula | C19H17N5 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 3-[3-(4-phenyl-2-pyridinyl)-1H-pyrazol-5-yl]pyrrolidine-1-carbonitrile |
| SMILES | N#CN1CCC(c2cc(-c3cc(-c4ccccc4)ccn3)n[nH]2)C1 |
| InChI | InChI=1S/C19H17N5/c20-13-24-9-7-16(12-24)17-11-19(23-22-17)18-10-15(6-8-21-18)14-4-2-1-3-5-14/h1-6,8,10-11,16H,7,9,12H2,(H,22,23) |
| InChIKey | HFGNAGHYGBCYAY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|