C9H10N4 — CID 130383086
(3R)-3-pyrimidin-5-ylpyrrolidine-1-carbonitrile (PubChem CID 130383086) has the molecular formula C9H10N4 and a molecular weight of 174.21 g/mol. Its IUPAC name is (3R)-3-pyrimidin-5-ylpyrrolidine-1-carbonitrile.
| Compound Name | (3R)-3-pyrimidin-5-ylpyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 130383086 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | (3R)-3-pyrimidin-5-ylpyrrolidine-1-carbonitrile |
| SMILES | N#CN1CC[C@H](c2cncnc2)C1 |
| InChI | InChI=1S/C9H10N4/c10-6-13-2-1-8(5-13)9-3-11-7-12-4-9/h3-4,7-8H,1-2,5H2/t8-/m0/s1 |
| InChIKey | YMAXRSZPZPVKIU-QMMMGPOBSA-N |
| XLogP | 0.75 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|