C17H16N6O — CID 130468569
3-[5-[3-(3-cyanophenyl)azetidin-1-yl]-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carbonitrile (PubChem CID 130468569) has the molecular formula C17H16N6O and a molecular weight of 320.36 g/mol. Its IUPAC name is 3-[5-[3-(3-cyanophenyl)azetidin-1-yl]-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carbonitrile.
| Compound Name | 3-[5-[3-(3-cyanophenyl)azetidin-1-yl]-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 130468569 |
| Molecular Formula | C17H16N6O |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 3-[5-[3-(3-cyanophenyl)azetidin-1-yl]-1,2,4-oxadiazol-3-yl]pyrrolidine-1-carbonitrile |
| SMILES | N#Cc1cccc(C2CN(c3nc(C4CCN(C#N)C4)no3)C2)c1 |
| InChI | InChI=1S/C17H16N6O/c18-7-12-2-1-3-13(6-12)15-9-23(10-15)17-20-16(21-24-17)14-4-5-22(8-14)11-19/h1-3,6,14-15H,4-5,8-10H2 |
| InChIKey | OJWCQADQZPFVHP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 92.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|