C15H14ClN7O — CID 155212551
3-amino-N-[1-[(3-amino-2-chlorophenyl)methyl]pyrazol-4-yl]pyrazine-2-carboxamide (PubChem CID 155212551) has the molecular formula C15H14ClN7O and a molecular weight of 343.78 g/mol. Its IUPAC name is 3-amino-N-[1-[(3-amino-2-chlorophenyl)methyl]pyrazol-4-yl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[1-[(3-amino-2-chlorophenyl)methyl]pyrazol-4-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 155212551 |
| Molecular Formula | C15H14ClN7O |
| Molecular Weight | 343.78 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 3-amino-N-[1-[(3-amino-2-chlorophenyl)methyl]pyrazol-4-yl]pyrazine-2-carboxamide |
| SMILES | Nc1cccc(Cn2cc(NC(=O)c3nccnc3N)cn2)c1Cl |
| InChI | InChI=1S/C15H14ClN7O/c16-12-9(2-1-3-11(12)17)7-23-8-10(6-21-23)22-15(24)13-14(18)20-5-4-19-13/h1-6,8H,7,17H2,(H2,18,20)(H,22,24) |
| InChIKey | HWNUSXXAANQVGP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 124.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.78 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|