C24H32N8O2 — CID 155712536
3-amino-N-[1-[[3-(1-propan-2-ylpiperidin-4-yl)phenyl]methyl]pyrazol-4-yl]pyrazine-2-carboxamide;formamide (PubChem CID 155712536) has the molecular formula C24H32N8O2 and a molecular weight of 464.57 g/mol. Its IUPAC name is 3-amino-N-[1-[[3-(1-propan-2-ylpiperidin-4-yl)phenyl]methyl]pyrazol-4-yl]pyrazine-2-carboxamide;formamide.
| Compound Name | 3-amino-N-[1-[[3-(1-propan-2-ylpiperidin-4-yl)phenyl]methyl]pyrazol-4-yl]pyrazine-2-carboxamide;formamide |
|---|---|
| PubChem CID | 155712536 |
| Molecular Formula | C24H32N8O2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | 3-amino-N-[1-[[3-(1-propan-2-ylpiperidin-4-yl)phenyl]methyl]pyrazol-4-yl]pyrazine-2-carboxamide;formamide |
| SMILES | CC(C)N1CCC(c2cccc(Cn3cc(NC(=O)c4nccnc4N)cn3)c2)CC1.NC=O |
| InChI | InChI=1S/C23H29N7O.CH3NO/c1-16(2)29-10-6-18(7-11-29)19-5-3-4-17(12-19)14-30-15-20(13-27-30)28-23(31)21-22(24)26-9-8-25-21;2-1-3/h3-5,8-9,12-13,15-16,18H,6-7,10-11,14H2,1-2H3,(H2,24,26)(H,28,31);1H,(H2,2,3) |
| InChIKey | MFAFYVFDKIZUSC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 145.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|