C19H19N7O2 — CID 155212808
3-amino-N-[1-[[3-(2-methylprop-2-enoylamino)phenyl]methyl]pyrazol-4-yl]pyrazine-2-carboxamide (PubChem CID 155212808) has the molecular formula C19H19N7O2 and a molecular weight of 377.41 g/mol. Its IUPAC name is 3-amino-N-[1-[[3-(2-methylprop-2-enoylamino)phenyl]methyl]pyrazol-4-yl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[1-[[3-(2-methylprop-2-enoylamino)phenyl]methyl]pyrazol-4-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 155212808 |
| Molecular Formula | C19H19N7O2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 3-amino-N-[1-[[3-(2-methylprop-2-enoylamino)phenyl]methyl]pyrazol-4-yl]pyrazine-2-carboxamide |
| SMILES | C=C(C)C(=O)Nc1cccc(Cn2cc(NC(=O)c3nccnc3N)cn2)c1 |
| InChI | InChI=1S/C19H19N7O2/c1-12(2)18(27)24-14-5-3-4-13(8-14)10-26-11-15(9-23-26)25-19(28)16-17(20)22-7-6-21-16/h3-9,11H,1,10H2,2H3,(H2,20,22)(H,24,27)(H,25,28) |
| InChIKey | UWDCPWMBBMCXQZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|