C16H13FN6O3 — CID 155220646
5-[[4-[(3-aminopyrazine-2-carbonyl)amino]pyrazol-1-yl]methyl]-2-fluorobenzoic acid (PubChem CID 155220646) has the molecular formula C16H13FN6O3 and a molecular weight of 356.32 g/mol. Its IUPAC name is 5-[[4-[(3-aminopyrazine-2-carbonyl)amino]pyrazol-1-yl]methyl]-2-fluorobenzoic acid.
| Compound Name | 5-[[4-[(3-aminopyrazine-2-carbonyl)amino]pyrazol-1-yl]methyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 155220646 |
| Molecular Formula | C16H13FN6O3 |
| Molecular Weight | 356.32 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 5-[[4-[(3-aminopyrazine-2-carbonyl)amino]pyrazol-1-yl]methyl]-2-fluorobenzoic acid |
| SMILES | Nc1nccnc1C(=O)Nc1cnn(Cc2ccc(F)c(C(=O)O)c2)c1 |
| InChI | InChI=1S/C16H13FN6O3/c17-12-2-1-9(5-11(12)16(25)26)7-23-8-10(6-21-23)22-15(24)13-14(18)20-4-3-19-13/h1-6,8H,7H2,(H2,18,20)(H,22,24)(H,25,26) |
| InChIKey | AJHOJVJDEWGYHY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |