C16H34O6 — CID 155214936
4-[2-[1-[4-(2-hydroxyethoxy)-2-methylbutan-2-yl]oxyethoxy]ethoxy]-2-methylbutan-2-ol (PubChem CID 155214936) has the molecular formula C16H34O6 and a molecular weight of 322.44 g/mol. Its IUPAC name is 4-[2-[1-[4-(2-hydroxyethoxy)-2-methylbutan-2-yl]oxyethoxy]ethoxy]-2-methylbutan-2-ol.
| Compound Name | 4-[2-[1-[4-(2-hydroxyethoxy)-2-methylbutan-2-yl]oxyethoxy]ethoxy]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 155214936 |
| Molecular Formula | C16H34O6 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 4-[2-[1-[4-(2-hydroxyethoxy)-2-methylbutan-2-yl]oxyethoxy]ethoxy]-2-methylbutan-2-ol |
| SMILES | CC(OCCOCCC(C)(C)O)OC(C)(C)CCOCCO |
| InChI | InChI=1S/C16H34O6/c1-14(21-13-12-20-9-6-15(2,3)18)22-16(4,5)7-10-19-11-8-17/h14,17-18H,6-13H2,1-5H3 |
| InChIKey | GKMYJFCJCWERAX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|