C11H18N2 — CID 155216876
2-(4-ethylcyclohexen-1-yl)-3,4-dihydropyrazole (PubChem CID 155216876) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 2-(4-ethylcyclohexen-1-yl)-3,4-dihydropyrazole.
| Compound Name | 2-(4-ethylcyclohexen-1-yl)-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 155216876 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 2-(4-ethylcyclohexen-1-yl)-3,4-dihydropyrazole |
| SMILES | CCC1CC=C(N2CCC=N2)CC1 |
| InChI | InChI=1S/C11H18N2/c1-2-10-4-6-11(7-5-10)13-9-3-8-12-13/h6,8,10H,2-5,7,9H2,1H3 |
| InChIKey | CDTUJGXTPVRBFK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |