C23H22F5NO — CID 155217307
(3,3-difluorocyclobutyl)-[8-[4-(2,2,2-trifluoroethyl)phenyl]-1,3,4,5-tetrahydro-2-benzazepin-2-yl]methanone (PubChem CID 155217307) has the molecular formula C23H22F5NO and a molecular weight of 423.43 g/mol. Its IUPAC name is (3,3-difluorocyclobutyl)-[8-[4-(2,2,2-trifluoroethyl)phenyl]-1,3,4,5-tetrahydro-2-benzazepin-2-yl]methanone.
| Compound Name | (3,3-difluorocyclobutyl)-[8-[4-(2,2,2-trifluoroethyl)phenyl]-1,3,4,5-tetrahydro-2-benzazepin-2-yl]methanone |
|---|---|
| PubChem CID | 155217307 |
| Molecular Formula | C23H22F5NO |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | (3,3-difluorocyclobutyl)-[8-[4-(2,2,2-trifluoroethyl)phenyl]-1,3,4,5-tetrahydro-2-benzazepin-2-yl]methanone |
| SMILES | O=C(C1CC(F)(F)C1)N1CCCc2ccc(-c3ccc(CC(F)(F)F)cc3)cc2C1 |
| InChI | InChI=1S/C23H22F5NO/c24-22(25)12-20(13-22)21(30)29-9-1-2-16-7-8-18(10-19(16)14-29)17-5-3-15(4-6-17)11-23(26,27)28/h3-8,10,20H,1-2,9,11-14H2 |
| InChIKey | ACLGMOSVDBKUKR-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |