C25H23ClN2O2 — CID 155218723
4-[4-(5-but-2-ynyl-3-oxo-1H-isoindol-2-yl)cyclohexyl]oxy-2-chlorobenzonitrile (PubChem CID 155218723) has the molecular formula C25H23ClN2O2 and a molecular weight of 418.92 g/mol. Its IUPAC name is 4-[4-(5-but-2-ynyl-3-oxo-1H-isoindol-2-yl)cyclohexyl]oxy-2-chlorobenzonitrile.
| Compound Name | 4-[4-(5-but-2-ynyl-3-oxo-1H-isoindol-2-yl)cyclohexyl]oxy-2-chlorobenzonitrile |
|---|---|
| PubChem CID | 155218723 |
| Molecular Formula | C25H23ClN2O2 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 4-[4-(5-but-2-ynyl-3-oxo-1H-isoindol-2-yl)cyclohexyl]oxy-2-chlorobenzonitrile |
| SMILES | CC#CCc1ccc2c(c1)C(=O)N(C1CCC(Oc3ccc(C#N)c(Cl)c3)CC1)C2 |
| InChI | InChI=1S/C25H23ClN2O2/c1-2-3-4-17-5-6-19-16-28(25(29)23(19)13-17)20-8-11-21(12-9-20)30-22-10-7-18(15-27)24(26)14-22/h5-7,10,13-14,20-21H,4,8-9,11-12,16H2,1H3 |
| InChIKey | GWMFDOSNNNWXFB-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|