C16H19F3N2O — CID 155221379
6-methyl-N-[4-(trifluoromethyl)phenyl]-1-azaspiro[2.5]octane-1-carboxamide (PubChem CID 155221379) has the molecular formula C16H19F3N2O and a molecular weight of 312.33 g/mol. Its IUPAC name is 6-methyl-N-[4-(trifluoromethyl)phenyl]-1-azaspiro[2.5]octane-1-carboxamide.
| Compound Name | 6-methyl-N-[4-(trifluoromethyl)phenyl]-1-azaspiro[2.5]octane-1-carboxamide |
|---|---|
| PubChem CID | 155221379 |
| Molecular Formula | C16H19F3N2O |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 6-methyl-N-[4-(trifluoromethyl)phenyl]-1-azaspiro[2.5]octane-1-carboxamide |
| SMILES | CC1CCC2(CC1)CN2C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H19F3N2O/c1-11-6-8-15(9-7-11)10-21(15)14(22)20-13-4-2-12(3-5-13)16(17,18)19/h2-5,11H,6-10H2,1H3,(H,20,22) |
| InChIKey | JTZGYVBGZVFNTE-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 32.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|