C18H25ClN2O — CID 155221391
N-(4-chlorophenyl)-2,8-dimethyl-2-azaspiro[4.5]decane-4-carboxamide (PubChem CID 155221391) has the molecular formula C18H25ClN2O and a molecular weight of 320.86 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2,8-dimethyl-2-azaspiro[4.5]decane-4-carboxamide.
| Compound Name | N-(4-chlorophenyl)-2,8-dimethyl-2-azaspiro[4.5]decane-4-carboxamide |
|---|---|
| PubChem CID | 155221391 |
| Molecular Formula | C18H25ClN2O |
| Molecular Weight | 320.86 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | N-(4-chlorophenyl)-2,8-dimethyl-2-azaspiro[4.5]decane-4-carboxamide |
| SMILES | CC1CCC2(CC1)CN(C)CC2C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H25ClN2O/c1-13-7-9-18(10-8-13)12-21(2)11-16(18)17(22)20-15-5-3-14(19)4-6-15/h3-6,13,16H,7-12H2,1-2H3,(H,20,22) |
| InChIKey | WLGAZHFGLYQOJC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.86 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |