C27H32O6 — CID 155222140
4-[(6S)-5-[(2-methoxyacetyl)oxymethyl]-4-methyl-6-phenyl-3,6-dihydro-2H-pyran-2-yl]butyl benzoate (PubChem CID 155222140) has the molecular formula C27H32O6 and a molecular weight of 452.55 g/mol. Its IUPAC name is 4-[(6S)-5-[(2-methoxyacetyl)oxymethyl]-4-methyl-6-phenyl-3,6-dihydro-2H-pyran-2-yl]butyl benzoate.
| Compound Name | 4-[(6S)-5-[(2-methoxyacetyl)oxymethyl]-4-methyl-6-phenyl-3,6-dihydro-2H-pyran-2-yl]butyl benzoate |
|---|---|
| PubChem CID | 155222140 |
| Molecular Formula | C27H32O6 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 4-[(6S)-5-[(2-methoxyacetyl)oxymethyl]-4-methyl-6-phenyl-3,6-dihydro-2H-pyran-2-yl]butyl benzoate |
| SMILES | COCC(=O)OCC1=C(C)CC(CCCCOC(=O)c2ccccc2)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C27H32O6/c1-20-17-23(15-9-10-16-31-27(29)22-13-7-4-8-14-22)33-26(21-11-5-3-6-12-21)24(20)18-32-25(28)19-30-2/h3-8,11-14,23,26H,9-10,15-19H2,1-2H3/t23?,26-/m0/s1 |
| InChIKey | LLGULOHXIIRYPY-NASUQTAISA-N |
| XLogP | 5.05 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|