C19H28O6S — CID 10339995
4-[(4R,7R)-7-butyl-2,2-dioxo-1,3,2-dioxathiepan-4-yl]butyl benzoate (PubChem CID 10339995) has the molecular formula C19H28O6S and a molecular weight of 384.49 g/mol. Its IUPAC name is 4-[(4R,7R)-7-butyl-2,2-dioxo-1,3,2-dioxathiepan-4-yl]butyl benzoate.
| Compound Name | 4-[(4R,7R)-7-butyl-2,2-dioxo-1,3,2-dioxathiepan-4-yl]butyl benzoate |
|---|---|
| PubChem CID | 10339995 |
| Molecular Formula | C19H28O6S |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 4-[(4R,7R)-7-butyl-2,2-dioxo-1,3,2-dioxathiepan-4-yl]butyl benzoate |
| SMILES | CCCC[C@@H]1CC[C@@H](CCCCOC(=O)c2ccccc2)OS(=O)(=O)O1 |
| InChI | InChI=1S/C19H28O6S/c1-2-3-11-17-13-14-18(25-26(21,22)24-17)12-7-8-15-23-19(20)16-9-5-4-6-10-16/h4-6,9-10,17-18H,2-3,7-8,11-15H2,1H3/t17-,18-/m1/s1 |
| InChIKey | RXFJQORMIXZNDA-QZTJIDSGSA-N |
| XLogP | 4.01 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|