C16H11F3N4O2S — CID 155223894
5-methoxy-5'-[6-(trifluoromethyl)-3-pyridinyl]spiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one (PubChem CID 155223894) has the molecular formula C16H11F3N4O2S and a molecular weight of 380.35 g/mol. Its IUPAC name is 5-methoxy-5'-[6-(trifluoromethyl)-3-pyridinyl]spiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one.
| Compound Name | 5-methoxy-5'-[6-(trifluoromethyl)-3-pyridinyl]spiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one |
|---|---|
| PubChem CID | 155223894 |
| Molecular Formula | C16H11F3N4O2S |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 5-methoxy-5'-[6-(trifluoromethyl)-3-pyridinyl]spiro[1H-indole-3,2'-3H-1,3,4-thiadiazole]-2-one |
| SMILES | COc1ccc2c(c1)C1(NN=C(c3ccc(C(F)(F)F)nc3)S1)C(=O)N2 |
| InChI | InChI=1S/C16H11F3N4O2S/c1-25-9-3-4-11-10(6-9)15(14(24)21-11)23-22-13(26-15)8-2-5-12(20-7-8)16(17,18)19/h2-7,23H,1H3,(H,21,24) |
| InChIKey | CFTNSMURSPZVLH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_5_B(2)', 'substructure': 'N/A'} |
|---|