C10H8F6N2OS2 — CID 155226907
(E)-N-methoxy-1-[2-(3,4,4-trifluorobut-3-enylsulfanyl)-4-(trifluoromethyl)-1,3-thiazol-5-yl]methanimine (PubChem CID 155226907) has the molecular formula C10H8F6N2OS2 and a molecular weight of 350.31 g/mol. Its IUPAC name is (E)-N-methoxy-1-[2-(3,4,4-trifluorobut-3-enylsulfanyl)-4-(trifluoromethyl)-1,3-thiazol-5-yl]methanimine.
| Compound Name | (E)-N-methoxy-1-[2-(3,4,4-trifluorobut-3-enylsulfanyl)-4-(trifluoromethyl)-1,3-thiazol-5-yl]methanimine |
|---|---|
| PubChem CID | 155226907 |
| Molecular Formula | C10H8F6N2OS2 |
| Molecular Weight | 350.31 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | (E)-N-methoxy-1-[2-(3,4,4-trifluorobut-3-enylsulfanyl)-4-(trifluoromethyl)-1,3-thiazol-5-yl]methanimine |
| SMILES | CO/N=C/c1sc(SCCC(F)=C(F)F)nc1C(F)(F)F |
| InChI | InChI=1S/C10H8F6N2OS2/c1-19-17-4-6-7(10(14,15)16)18-9(21-6)20-3-2-5(11)8(12)13/h4H,2-3H2,1H3/b17-4+ |
| InChIKey | NHIMWZPNOUXIFL-HAVNEIBRSA-N |
| XLogP | 4.70 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.31 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|