C10H11F3N2O2S — CID 155231142
N-ethoxy-1-[2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-oxazol-5-yl]methanimine (PubChem CID 155231142) has the molecular formula C10H11F3N2O2S and a molecular weight of 280.27 g/mol. Its IUPAC name is N-ethoxy-1-[2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-oxazol-5-yl]methanimine.
| Compound Name | N-ethoxy-1-[2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-oxazol-5-yl]methanimine |
|---|---|
| PubChem CID | 155231142 |
| Molecular Formula | C10H11F3N2O2S |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | N-ethoxy-1-[2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-oxazol-5-yl]methanimine |
| SMILES | CCON=Cc1cnc(SCCC(F)=C(F)F)o1 |
| InChI | InChI=1S/C10H11F3N2O2S/c1-2-16-15-6-7-5-14-10(17-7)18-4-3-8(11)9(12)13/h5-6H,2-4H2,1H3 |
| InChIKey | AAYGYNJXCUONOG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 47.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|