C15H21F3N2O2S — CID 155231093
(E)-1-[4-tert-butyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-oxazol-5-yl]-N-ethoxyethanimine (PubChem CID 155231093) has the molecular formula C15H21F3N2O2S and a molecular weight of 350.41 g/mol. Its IUPAC name is (E)-1-[4-tert-butyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-oxazol-5-yl]-N-ethoxyethanimine.
| Compound Name | (E)-1-[4-tert-butyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-oxazol-5-yl]-N-ethoxyethanimine |
|---|---|
| PubChem CID | 155231093 |
| Molecular Formula | C15H21F3N2O2S |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (E)-1-[4-tert-butyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-oxazol-5-yl]-N-ethoxyethanimine |
| SMILES | CCO/N=C(\C)c1oc(SCCC(F)=C(F)F)nc1C(C)(C)C |
| InChI | InChI=1S/C15H21F3N2O2S/c1-6-21-20-9(2)11-12(15(3,4)5)19-14(22-11)23-8-7-10(16)13(17)18/h6-8H2,1-5H3/b20-9+ |
| InChIKey | FBJVZYJZRXRGGG-AWQFTUOYSA-N |
| XLogP | 5.29 |
| TPSA | 47.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|