C10H11F3N2O2S — CID 151947773
N-methyl-1-[4-methyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-oxazol-5-yl]methanimine oxide (PubChem CID 151947773) has the molecular formula C10H11F3N2O2S and a molecular weight of 280.27 g/mol. Its IUPAC name is N-methyl-1-[4-methyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-oxazol-5-yl]methanimine oxide.
| Compound Name | N-methyl-1-[4-methyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-oxazol-5-yl]methanimine oxide |
|---|---|
| PubChem CID | 151947773 |
| Molecular Formula | C10H11F3N2O2S |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | N-methyl-1-[4-methyl-2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-oxazol-5-yl]methanimine oxide |
| SMILES | Cc1nc(SCCC(F)=C(F)F)oc1/C=[N+](/C)[O-] |
| InChI | InChI=1S/C10H11F3N2O2S/c1-6-8(5-15(2)16)17-10(14-6)18-4-3-7(11)9(12)13/h5H,3-4H2,1-2H3/b15-5- |
| InChIKey | TVZQRDFKQKVFPB-WCSRMQSCSA-N |
| XLogP | 3.10 |
| TPSA | 52.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|