C18H32N2O3 — CID 155229194
2,3-bis(3-propoxypropylamino)phenol (PubChem CID 155229194) has the molecular formula C18H32N2O3 and a molecular weight of 324.47 g/mol. Its IUPAC name is 2,3-bis(3-propoxypropylamino)phenol.
| Compound Name | 2,3-bis(3-propoxypropylamino)phenol |
|---|---|
| PubChem CID | 155229194 |
| Molecular Formula | C18H32N2O3 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.24 |
| IUPAC Name | 2,3-bis(3-propoxypropylamino)phenol |
| SMILES | CCCOCCCNc1cccc(O)c1NCCCOCCC |
| InChI | InChI=1S/C18H32N2O3/c1-3-12-22-14-6-10-19-16-8-5-9-17(21)18(16)20-11-7-15-23-13-4-2/h5,8-9,19-21H,3-4,6-7,10-15H2,1-2H3 |
| InChIKey | VGGWGCSWFZJILM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|