C17H18IN3O3 — CID 155229909
5-[2-(4-hydroxypentoxy)phenyl]-7-iodo-3H-pyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 155229909) has the molecular formula C17H18IN3O3 and a molecular weight of 439.25 g/mol. Its IUPAC name is 5-[2-(4-hydroxypentoxy)phenyl]-7-iodo-3H-pyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 5-[2-(4-hydroxypentoxy)phenyl]-7-iodo-3H-pyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 155229909 |
| Molecular Formula | C17H18IN3O3 |
| Molecular Weight | 439.25 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | 5-[2-(4-hydroxypentoxy)phenyl]-7-iodo-3H-pyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | CC(O)CCCOc1ccccc1-n1cc(I)c2nc[nH]c(=O)c21 |
| InChI | InChI=1S/C17H18IN3O3/c1-11(22)5-4-8-24-14-7-3-2-6-13(14)21-9-12(18)15-16(21)17(23)20-10-19-15/h2-3,6-7,9-11,22H,4-5,8H2,1H3,(H,19,20,23) |
| InChIKey | JANKZGVFPIOLAA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|