C15H23NO6 — CID 155231261
[(3'aR,6'aS)-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-yl]-carboxycarbamic acid (PubChem CID 155231261) has the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. Its IUPAC name is [(3'aR,6'aS)-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-yl]-carboxycarbamic acid.
| Compound Name | [(3'aR,6'aS)-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-yl]-carboxycarbamic acid |
|---|---|
| PubChem CID | 155231261 |
| Molecular Formula | C15H23NO6 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | [(3'aR,6'aS)-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-yl]-carboxycarbamic acid |
| SMILES | CC1(C)COC2(C[C@H]3CC(N(C(=O)O)C(=O)O)C[C@H]3C2)OC1 |
| InChI | InChI=1S/C15H23NO6/c1-14(2)7-21-15(22-8-14)5-9-3-11(4-10(9)6-15)16(12(17)18)13(19)20/h9-11H,3-8H2,1-2H3,(H,17,18)(H,19,20)/t9-,10+,11? |
| InChIKey | COASOHYWCQUEBN-ZACCUICWSA-N |
| XLogP | 2.60 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |