C13H22O3S — CID 167097543
(3'aR,6'aS)-5,5-dimethyl-2'-sulfanyloxyspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene] (PubChem CID 167097543) has the molecular formula C13H22O3S and a molecular weight of 258.38 g/mol. Its IUPAC name is (3'aR,6'aS)-5,5-dimethyl-2'-sulfanyloxyspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene].
| Compound Name | (3'aR,6'aS)-5,5-dimethyl-2'-sulfanyloxyspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene] |
|---|---|
| PubChem CID | 167097543 |
| Molecular Formula | C13H22O3S |
| Molecular Weight | 258.38 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | (3'aR,6'aS)-5,5-dimethyl-2'-sulfanyloxyspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene] |
| SMILES | CC1(C)COC2(C[C@H]3CC(OS)C[C@H]3C2)OC1 |
| InChI | InChI=1S/C13H22O3S/c1-12(2)7-14-13(15-8-12)5-9-3-11(16-17)4-10(9)6-13/h9-11,17H,3-8H2,1-2H3/t9-,10+,11? |
| InChIKey | XTKPYRMZLKEWSX-ZACCUICWSA-N |
| XLogP | 2.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|