C20H22F3N3O2 — CID 155231270
tert-butyl (3aR,6aS)-5-[6-(trifluoromethyl)imidazo[1,5-a]pyridin-8-yl]-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (PubChem CID 155231270) has the molecular formula C20H22F3N3O2 and a molecular weight of 393.41 g/mol. Its IUPAC name is tert-butyl (3aR,6aS)-5-[6-(trifluoromethyl)imidazo[1,5-a]pyridin-8-yl]-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl (3aR,6aS)-5-[6-(trifluoromethyl)imidazo[1,5-a]pyridin-8-yl]-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 155231270 |
| Molecular Formula | C20H22F3N3O2 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | tert-butyl (3aR,6aS)-5-[6-(trifluoromethyl)imidazo[1,5-a]pyridin-8-yl]-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CC(c3cc(C(F)(F)F)cn4cncc34)=C[C@H]2C1 |
| InChI | InChI=1S/C20H22F3N3O2/c1-19(2,3)28-18(27)25-8-13-4-12(5-14(13)9-25)16-6-15(20(21,22)23)10-26-11-24-7-17(16)26/h4,6-7,10-11,13-14H,5,8-9H2,1-3H3/t13-,14+/m0/s1 |
| InChIKey | DNRQDWLUPKPBBI-UONOGXRCSA-N |
| XLogP | 4.62 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |