C19H24ClN3O3 — CID 154696890
tert-butyl 5-(6-chloroimidazo[1,5-a]pyridin-8-yl)-5-hydroxy-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate (PubChem CID 154696890) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is tert-butyl 5-(6-chloroimidazo[1,5-a]pyridin-8-yl)-5-hydroxy-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl 5-(6-chloroimidazo[1,5-a]pyridin-8-yl)-5-hydroxy-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 154696890 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | tert-butyl 5-(6-chloroimidazo[1,5-a]pyridin-8-yl)-5-hydroxy-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CC(O)(c3cc(Cl)cn4cncc34)CC2C1 |
| InChI | InChI=1S/C19H24ClN3O3/c1-18(2,3)26-17(24)22-8-12-5-19(25,6-13(12)9-22)15-4-14(20)10-23-11-21-7-16(15)23/h4,7,10-13,25H,5-6,8-9H2,1-3H3 |
| InChIKey | ZSCUIJFOQLFABA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |