C27H35Cl2N3O3S — CID 155237859
[(Z)-2-hydroxyhex-3-en-2-yl] 4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-N-ethylpiperidine-1-carboximidothioate (PubChem CID 155237859) has the molecular formula C27H35Cl2N3O3S and a molecular weight of 552.57 g/mol. Its IUPAC name is [(Z)-2-hydroxyhex-3-en-2-yl] 4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-N-ethylpiperidine-1-carboximidothioate.
| Compound Name | [(Z)-2-hydroxyhex-3-en-2-yl] 4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-N-ethylpiperidine-1-carboximidothioate |
|---|---|
| PubChem CID | 155237859 |
| Molecular Formula | C27H35Cl2N3O3S |
| Molecular Weight | 552.57 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | [(Z)-2-hydroxyhex-3-en-2-yl] 4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-N-ethylpiperidine-1-carboximidothioate |
| SMILES | CC/C=C\C(C)(O)S/C(=N\CC)N1CCC(OCc2c(-c3c(Cl)cccc3Cl)noc2C2CC2)CC1 |
| InChI | InChI=1S/C27H35Cl2N3O3S/c1-4-6-14-27(3,33)36-26(30-5-2)32-15-12-19(13-16-32)34-17-20-24(31-35-25(20)18-10-11-18)23-21(28)8-7-9-22(23)29/h6-9,14,18-19,33H,4-5,10-13,15-17H2,1-3H3/b14-6-,30-26- |
| InChIKey | MRHZBHXHHONCTQ-LMJRLINGSA-N |
| XLogP | 7.29 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.57 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|