C24H30N2O4 — CID 155238791
[2-hydroxy-3-[3-(1-methylindol-2-yl)phenoxy]propyl] 3-methyl-2-(methylamino)butanoate (PubChem CID 155238791) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is [2-hydroxy-3-[3-(1-methylindol-2-yl)phenoxy]propyl] 3-methyl-2-(methylamino)butanoate.
| Compound Name | [2-hydroxy-3-[3-(1-methylindol-2-yl)phenoxy]propyl] 3-methyl-2-(methylamino)butanoate |
|---|---|
| PubChem CID | 155238791 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | [2-hydroxy-3-[3-(1-methylindol-2-yl)phenoxy]propyl] 3-methyl-2-(methylamino)butanoate |
| SMILES | CNC(C(=O)OCC(O)COc1cccc(-c2cc3ccccc3n2C)c1)C(C)C |
| InChI | InChI=1S/C24H30N2O4/c1-16(2)23(25-3)24(28)30-15-19(27)14-29-20-10-7-9-17(12-20)22-13-18-8-5-6-11-21(18)26(22)4/h5-13,16,19,23,25,27H,14-15H2,1-4H3 |
| InChIKey | CBQWJELNQXITIA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |